C25H27ClF2N2O4 — CID 158392728
2-[1-[4-[4-[(4-chloro-3-methylbenzoyl)amino]butanoyl]-2,5-difluorophenyl]piperidin-4-yl]acetic acid (PubChem CID 158392728) has the molecular formula C25H27ClF2N2O4 and a molecular weight of 492.95 g/mol. Its IUPAC name is 2-[1-[4-[4-[(4-chloro-3-methylbenzoyl)amino]butanoyl]-2,5-difluorophenyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[4-[4-[(4-chloro-3-methylbenzoyl)amino]butanoyl]-2,5-difluorophenyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 158392728 |
| Molecular Formula | C25H27ClF2N2O4 |
| Molecular Weight | 492.95 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[1-[4-[4-[(4-chloro-3-methylbenzoyl)amino]butanoyl]-2,5-difluorophenyl]piperidin-4-yl]acetic acid |
| SMILES | Cc1cc(C(=O)NCCCC(=O)c2cc(F)c(N3CCC(CC(=O)O)CC3)cc2F)ccc1Cl |
| InChI | InChI=1S/C25H27ClF2N2O4/c1-15-11-17(4-5-19(15)26)25(34)29-8-2-3-23(31)18-13-21(28)22(14-20(18)27)30-9-6-16(7-10-30)12-24(32)33/h4-5,11,13-14,16H,2-3,6-10,12H2,1H3,(H,29,34)(H,32,33) |
| InChIKey | GXDYMCSCUIAQLC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|