C19H18N4O4S — CID 158395353
17,20-dioxa-3-thia-7,10,11,26-tetrazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8(12),9,21,23-heptaene-6,13-dione (PubChem CID 158395353) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 17,20-dioxa-3-thia-7,10,11,26-tetrazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8(12),9,21,23-heptaene-6,13-dione.
| Compound Name | 17,20-dioxa-3-thia-7,10,11,26-tetrazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8(12),9,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 158395353 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 17,20-dioxa-3-thia-7,10,11,26-tetrazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8(12),9,21,23-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn[nH]c2C(=O)CCCOCCOc2cccc(c2)-c2nc1cs2 |
| InChI | InChI=1S/C19H18N4O4S/c24-16-5-2-6-26-7-8-27-13-4-1-3-12(9-13)19-22-15(11-28-19)18(25)21-14-10-20-23-17(14)16/h1,3-4,9-11H,2,5-8H2,(H,20,23)(H,21,25) |
| InChIKey | YSCZINXSBUTOGG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |