C35H36ClF6N7O4 — CID 158397120
1-chloro-2-nitro-4-(trifluoromethyl)benzene;1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(pyridin-2-ylmethyl)piperazine;2-(piperidin-1-ylmethyl)pyridine (PubChem CID 158397120) has the molecular formula C35H36ClF6N7O4 and a molecular weight of 768.16 g/mol. Its IUPAC name is 1-chloro-2-nitro-4-(trifluoromethyl)benzene;1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(pyridin-2-ylmethyl)piperazine;2-(piperidin-1-ylmethyl)pyridine.
| Compound Name | 1-chloro-2-nitro-4-(trifluoromethyl)benzene;1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(pyridin-2-ylmethyl)piperazine;2-(piperidin-1-ylmethyl)pyridine |
|---|---|
| PubChem CID | 158397120 |
| Molecular Formula | C35H36ClF6N7O4 |
| Molecular Weight | 768.16 g/mol |
| Exact Mass | 767.24 |
| IUPAC Name | 1-chloro-2-nitro-4-(trifluoromethyl)benzene;1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(pyridin-2-ylmethyl)piperazine;2-(piperidin-1-ylmethyl)pyridine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Cl.O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(Cc2ccccn2)CC1.c1ccc(CN2CCCCC2)nc1 |
| InChI | InChI=1S/C17H17F3N4O2.C11H16N2.C7H3ClF3NO2/c18-17(19,20)13-4-5-15(16(11-13)24(25)26)23-9-7-22(8-10-23)12-14-3-1-2-6-21-14;1-4-8-13(9-5-1)10-11-6-2-3-7-12-11;8-5-2-1-4(7(9,10)11)3-6(5)12(13)14/h1-6,11H,7-10,12H2;2-3,6-7H,1,4-5,8-10H2;1-3H |
| InChIKey | GXQKGZHEXZTSPS-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.16 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|