C32H21Cl2F2N5O4 — CID 154020501
2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-pyridin-2-ylpyridine (PubChem CID 154020501) has the molecular formula C32H21Cl2F2N5O4 and a molecular weight of 648.45 g/mol. Its IUPAC name is 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-pyridin-2-ylpyridine.
| Compound Name | 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 154020501 |
| Molecular Formula | C32H21Cl2F2N5O4 |
| Molecular Weight | 648.45 g/mol |
| Exact Mass | 647.09 |
| IUPAC Name | 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-pyridin-2-ylpyridine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cc(F)c(-c3cc(-c4ccccn4)ccn3)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H21Cl2F2N5O4/c33-22-6-4-19(14-30(22)40(42)43)28-8-9-29(20-5-7-23(34)31(15-20)41(44)45)39(28)21-16-24(35)32(25(36)17-21)27-13-18(10-12-38-27)26-3-1-2-11-37-26/h1-7,10-17,28-29H,8-9H2/t28-,29-/m1/s1 |
| InChIKey | QCADDBDYROCKPD-FQLXRVMXSA-N |
| XLogP | 9.29 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.45 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|