C22H23ClN2O3 — CID 158397617
6-(2-chloroacetyl)-3-methyl-3,4-dihydro-1H-quinolin-2-one;3-methyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 158397617) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 6-(2-chloroacetyl)-3-methyl-3,4-dihydro-1H-quinolin-2-one;3-methyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-chloroacetyl)-3-methyl-3,4-dihydro-1H-quinolin-2-one;3-methyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 158397617 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 6-(2-chloroacetyl)-3-methyl-3,4-dihydro-1H-quinolin-2-one;3-methyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC1Cc2cc(C(=O)CCl)ccc2NC1=O.CC1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C12H12ClNO2.C10H11NO/c1-7-4-9-5-8(11(15)6-13)2-3-10(9)14-12(7)16;1-7-6-8-4-2-3-5-9(8)11-10(7)12/h2-3,5,7H,4,6H2,1H3,(H,14,16);2-5,7H,6H2,1H3,(H,11,12) |
| InChIKey | GXRYWILLXOYEOH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|