C26H37NO4S — CID 158399824
N-[4-(5-acetyl-2-adamantyl)-2-methyl-3-oxobutan-2-yl]-N-ethyl-2-methylbenzenesulfonamide (PubChem CID 158399824) has the molecular formula C26H37NO4S and a molecular weight of 459.65 g/mol. Its IUPAC name is N-[4-(5-acetyl-2-adamantyl)-2-methyl-3-oxobutan-2-yl]-N-ethyl-2-methylbenzenesulfonamide.
| Compound Name | N-[4-(5-acetyl-2-adamantyl)-2-methyl-3-oxobutan-2-yl]-N-ethyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 158399824 |
| Molecular Formula | C26H37NO4S |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[4-(5-acetyl-2-adamantyl)-2-methyl-3-oxobutan-2-yl]-N-ethyl-2-methylbenzenesulfonamide |
| SMILES | CCN(C(C)(C)C(=O)CC1C2CC3CC1CC(C(C)=O)(C3)C2)S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C26H37NO4S/c1-6-27(32(30,31)23-10-8-7-9-17(23)2)25(4,5)24(29)13-22-20-11-19-12-21(22)16-26(14-19,15-20)18(3)28/h7-10,19-22H,6,11-16H2,1-5H3 |
| InChIKey | IINLOIMERRXICA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |