About deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one
deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one (PubChem CID 161336701) has the molecular formula C18H33NO
and a molecular weight of 280.47 g/mol. Its IUPAC name is deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one.
Molecular Properties
| Compound Name | deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one |
| PubChem CID | 161336701 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 280.47 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one |
| SMILES | CN(C)C(C)(C)C(=O)CC1C2CC3CC1CC(C)(C3)C2.[H][2H] |
| InChI | InChI=1S/C18H31NO.H2/c1-17(2,19(4)5)16(20)8-15-13-6-12-7-14(15)11-18(3,9-12)10-13;/h12-15H,6-11H2,1-5H3;1H/i;1+1 |
| InChIKey | VMCWOPBYIDPHKL-IEOVAKBOSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one?
The IUPAC name of deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one (CID 161336701) is deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one.
What is the SMILES notation for deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one?
The canonical SMILES for deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one is CN(C)C(C)(C)C(=O)CC1C2CC3CC1CC(C)(C3)C2.[H][2H].
What is the InChIKey of deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one?
The InChIKey is VMCWOPBYIDPHKL-IEOVAKBOSA-N. The full InChI is InChI=1S/C18H31NO.H2/c1-17(2,19(4)5)16(20)8-15-13-6-12-7-14(15)11-18(3,9-12)10-13;/h12-15H,6-11H2,1-5H3;1H/i;1+1.
What are the key properties of deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one?
deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one has a molecular weight of 280.47 g/mol, XLogP of 3.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;3-(dimethylamino)-3-methyl-1-(5-methyl-2-adamantyl)butan-2-one is sourced from PubChem (CID 161336701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).