C23H22F4N2O4 — CID 15840434
1-[1-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]acetyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 15840434) has the molecular formula C23H22F4N2O4 and a molecular weight of 466.43 g/mol. Its IUPAC name is 1-[1-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]acetyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]acetyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 15840434 |
| Molecular Formula | C23H22F4N2O4 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-[1-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]acetyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C(Cc1ccccc1OC(F)(F)C(F)F)N1CCC(N2C(=O)OCc3ccccc32)CC1 |
| InChI | InChI=1S/C23H22F4N2O4/c24-21(25)23(26,27)33-19-8-4-2-5-15(19)13-20(30)28-11-9-17(10-12-28)29-18-7-3-1-6-16(18)14-32-22(29)31/h1-8,17,21H,9-14H2 |
| InChIKey | LTNYIVSHLFCNNM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|