C18H18N2O3S — CID 70106844
1-[1-(thiophene-2-carbonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 70106844) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-[1-(thiophene-2-carbonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-(thiophene-2-carbonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 70106844 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[1-(thiophene-2-carbonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C(c1cccs1)N1CCC(N2C(=O)OCc3ccccc32)CC1 |
| InChI | InChI=1S/C18H18N2O3S/c21-17(16-6-3-11-24-16)19-9-7-14(8-10-19)20-15-5-2-1-4-13(15)12-23-18(20)22/h1-6,11,14H,7-10,12H2 |
| InChIKey | LDOLZTGDTQPJJH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |