C16H22O5 — CID 158404898
1-(6-acetyl-2,3-dimethoxyphenoxy)hexan-2-one (PubChem CID 158404898) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(6-acetyl-2,3-dimethoxyphenoxy)hexan-2-one.
| Compound Name | 1-(6-acetyl-2,3-dimethoxyphenoxy)hexan-2-one |
|---|---|
| PubChem CID | 158404898 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-(6-acetyl-2,3-dimethoxyphenoxy)hexan-2-one |
| SMILES | CCCCC(=O)COc1c(C(C)=O)ccc(OC)c1OC |
| InChI | InChI=1S/C16H22O5/c1-5-6-7-12(18)10-21-15-13(11(2)17)8-9-14(19-3)16(15)20-4/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | CEWSIJQQZVVYLH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |