C16H22O7 — CID 69042998
methyl 2-(2-butoxy-2-oxoethoxy)-3,4-dimethoxybenzoate (PubChem CID 69042998) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl 2-(2-butoxy-2-oxoethoxy)-3,4-dimethoxybenzoate.
| Compound Name | methyl 2-(2-butoxy-2-oxoethoxy)-3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 69042998 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | methyl 2-(2-butoxy-2-oxoethoxy)-3,4-dimethoxybenzoate |
| SMILES | CCCCOC(=O)COc1c(C(=O)OC)ccc(OC)c1OC |
| InChI | InChI=1S/C16H22O7/c1-5-6-9-22-13(17)10-23-14-11(16(18)21-4)7-8-12(19-2)15(14)20-3/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | JAXWCIJATDOMRF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|