C22H39O12P — CID 158409674
(2,5-dioxocyclopentyl) 4-[2-[2-[2-(2-methoxyethoxy)ethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxyethoxy]ethoxy]butanoate (PubChem CID 158409674) has the molecular formula C22H39O12P and a molecular weight of 526.52 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 4-[2-[2-[2-(2-methoxyethoxy)ethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxyethoxy]ethoxy]butanoate.
| Compound Name | (2,5-dioxocyclopentyl) 4-[2-[2-[2-(2-methoxyethoxy)ethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxyethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 158409674 |
| Molecular Formula | C22H39O12P |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (2,5-dioxocyclopentyl) 4-[2-[2-[2-(2-methoxyethoxy)ethoxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxyethoxy]ethoxy]butanoate |
| SMILES | COCCOCCOP(=O)(OCCOCCOCCCC(=O)OC1C(=O)CCC1=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39O12P/c1-22(2,3)34-35(26,31-16-14-29-11-10-27-4)32-17-15-30-13-12-28-9-5-6-20(25)33-21-18(23)7-8-19(21)24/h21H,5-17H2,1-4H3 |
| InChIKey | PNYIOIZVQUGKTK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|