C15H19NO6 — CID 171475250
(2,5-dioxocyclopentyl) 6-(2,5-dioxopyrrolidin-1-yl)hexanoate (PubChem CID 171475250) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 6-(2,5-dioxopyrrolidin-1-yl)hexanoate.
| Compound Name | (2,5-dioxocyclopentyl) 6-(2,5-dioxopyrrolidin-1-yl)hexanoate |
|---|---|
| PubChem CID | 171475250 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2,5-dioxocyclopentyl) 6-(2,5-dioxopyrrolidin-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)CCC1=O)OC1C(=O)CCC1=O |
| InChI | InChI=1S/C15H19NO6/c17-10-5-6-11(18)15(10)22-14(21)4-2-1-3-9-16-12(19)7-8-13(16)20/h15H,1-9H2 |
| InChIKey | NCGANPUMCDWJGS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|