C17H21NO5 — CID 21305622
3-oxatricyclo[3.2.1.02,4]octan-6-yl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 21305622) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-oxatricyclo[3.2.1.02,4]octan-6-yl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | 3-oxatricyclo[3.2.1.02,4]octan-6-yl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 21305622 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-oxatricyclo[3.2.1.02,4]octan-6-yl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OC1CC2CC1C1OC21 |
| InChI | InChI=1S/C17H21NO5/c19-13-5-6-14(20)18(13)7-3-1-2-4-15(21)22-12-9-10-8-11(12)17-16(10)23-17/h5-6,10-12,16-17H,1-4,7-9H2 |
| InChIKey | PPJJCBNYMMLCHB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|