C14H16N2O6 — CID 22629903
1-[6-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-6-oxohexyl]pyrrole-2,5-dione (PubChem CID 22629903) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-[6-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-6-oxohexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-6-oxohexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22629903 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[6-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-6-oxohexyl]pyrrole-2,5-dione |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)C1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C14H16N2O6/c17-10(9-8-13(20)16(22)14(9)21)4-2-1-3-7-15-11(18)5-6-12(15)19/h5-6,9,22H,1-4,7-8H2 |
| InChIKey | LYLMANSTAHZWBY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|