C20H27N2NaO8S — CID 163199615
sodium 1-[12-(2,5-dioxopyrrol-1-yl)-2-oxododecyl]-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 163199615) has the molecular formula C20H27N2NaO8S and a molecular weight of 478.50 g/mol. Its IUPAC name is sodium 1-[12-(2,5-dioxopyrrol-1-yl)-2-oxododecyl]-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | sodium 1-[12-(2,5-dioxopyrrol-1-yl)-2-oxododecyl]-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 163199615 |
| Molecular Formula | C20H27N2NaO8S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | sodium 1-[12-(2,5-dioxopyrrol-1-yl)-2-oxododecyl]-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | O=C(CCCCCCCCCCN1C(=O)C=CC1=O)CN1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C20H28N2O8S.Na/c23-15(14-22-19(26)13-16(20(22)27)31(28,29)30)9-7-5-3-1-2-4-6-8-12-21-17(24)10-11-18(21)25;/h10-11,16H,1-9,12-14H2,(H,28,29,30);/q;+1/p-1 |
| InChIKey | FWFLEAJCDGQBQY-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 149.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|