C17H22NO7S- — CID 176592176
1-[2-(1-adamantylmethoxy)-2-oxoethyl]-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 176592176) has the molecular formula C17H22NO7S- and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[2-(1-adamantylmethoxy)-2-oxoethyl]-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | 1-[2-(1-adamantylmethoxy)-2-oxoethyl]-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 176592176 |
| Molecular Formula | C17H22NO7S- |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[2-(1-adamantylmethoxy)-2-oxoethyl]-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | O=C(CN1C(=O)CC(S(=O)(=O)[O-])C1=O)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H23NO7S/c19-14-4-13(26(22,23)24)16(21)18(14)8-15(20)25-9-17-5-10-1-11(6-17)3-12(2-10)7-17/h10-13H,1-9H2,(H,22,23,24)/p-1 |
| InChIKey | VVEURBAZQOOAMT-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|