C40H42O24 — CID 89148627
4-O-(2,5-dioxocyclopentyl) 1-O-[2,3,4-tris[[4-(2,5-dioxocyclopentyl)oxy-4-oxobutanoyl]oxy]butyl] butanedioate (PubChem CID 89148627) has the molecular formula C40H42O24 and a molecular weight of 906.75 g/mol. Its IUPAC name is 4-O-(2,5-dioxocyclopentyl) 1-O-[2,3,4-tris[[4-(2,5-dioxocyclopentyl)oxy-4-oxobutanoyl]oxy]butyl] butanedioate.
| Compound Name | 4-O-(2,5-dioxocyclopentyl) 1-O-[2,3,4-tris[[4-(2,5-dioxocyclopentyl)oxy-4-oxobutanoyl]oxy]butyl] butanedioate |
|---|---|
| PubChem CID | 89148627 |
| Molecular Formula | C40H42O24 |
| Molecular Weight | 906.75 g/mol |
| Exact Mass | 906.21 |
| IUPAC Name | 4-O-(2,5-dioxocyclopentyl) 1-O-[2,3,4-tris[[4-(2,5-dioxocyclopentyl)oxy-4-oxobutanoyl]oxy]butyl] butanedioate |
| SMILES | O=C(CCC(=O)OC1C(=O)CCC1=O)OCC(OC(=O)CCC(=O)OC1C(=O)CCC1=O)C(COC(=O)CCC(=O)OC1C(=O)CCC1=O)OC(=O)CCC(=O)OC1C(=O)CCC1=O |
| InChI | InChI=1S/C40H42O24/c41-19-1-2-20(42)37(19)61-33(53)11-9-29(49)57-17-27(59-31(51)13-15-35(55)63-39-23(45)5-6-24(39)46)28(60-32(52)14-16-36(56)64-40-25(47)7-8-26(40)48)18-58-30(50)10-12-34(54)62-38-21(43)3-4-22(38)44/h27-28,37-40H,1-18H2 |
| InChIKey | JKEJHPMKTWASHI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 346.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.75 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|