C30H45BN4O11P2S — CID 158418134
[3-[3-[2-[(1R)-1-[[(2S)-2-benzyl-4-oxo-4-pyrazin-2-ylbutanoyl]amino]-3-methylbutyl]-1,3,6,2-dioxazaborocan-6-yl]propylsulfanyl]-3-oxo-1-phosphonopropyl]phosphonic acid (PubChem CID 158418134) has the molecular formula C30H45BN4O11P2S and a molecular weight of 742.53 g/mol. Its IUPAC name is [3-[3-[2-[(1R)-1-[[(2S)-2-benzyl-4-oxo-4-pyrazin-2-ylbutanoyl]amino]-3-methylbutyl]-1,3,6,2-dioxazaborocan-6-yl]propylsulfanyl]-3-oxo-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[3-[2-[(1R)-1-[[(2S)-2-benzyl-4-oxo-4-pyrazin-2-ylbutanoyl]amino]-3-methylbutyl]-1,3,6,2-dioxazaborocan-6-yl]propylsulfanyl]-3-oxo-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 158418134 |
| Molecular Formula | C30H45BN4O11P2S |
| Molecular Weight | 742.53 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | [3-[3-[2-[(1R)-1-[[(2S)-2-benzyl-4-oxo-4-pyrazin-2-ylbutanoyl]amino]-3-methylbutyl]-1,3,6,2-dioxazaborocan-6-yl]propylsulfanyl]-3-oxo-1-phosphonopropyl]phosphonic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(=O)c1cnccn1)Cc1ccccc1)B1OCCN(CCCSC(=O)CC(P(=O)(O)O)P(=O)(O)O)CCO1 |
| InChI | InChI=1S/C30H45BN4O11P2S/c1-22(2)17-27(34-30(38)24(18-23-7-4-3-5-8-23)19-26(36)25-21-32-9-10-33-25)31-45-14-12-35(13-15-46-31)11-6-16-49-28(37)20-29(47(39,40)41)48(42,43)44/h3-5,7-10,21-22,24,27,29H,6,11-20H2,1-2H3,(H,34,38)(H2,39,40,41)(H2,42,43,44)/t24-,27-/m0/s1 |
| InChIKey | AFFHHSCBBJLICZ-IGKIAQTJSA-N |
| XLogP | 2.54 |
| TPSA | 225.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|