C26H30N2O6 — CID 158418727
benzyl 4-[dimethoxymethyl(methyl)amino]benzoate;4-(methylamino)benzoic acid (PubChem CID 158418727) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is benzyl 4-[dimethoxymethyl(methyl)amino]benzoate;4-(methylamino)benzoic acid.
| Compound Name | benzyl 4-[dimethoxymethyl(methyl)amino]benzoate;4-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 158418727 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | benzyl 4-[dimethoxymethyl(methyl)amino]benzoate;4-(methylamino)benzoic acid |
| SMILES | CNc1ccc(C(=O)O)cc1.COC(OC)N(C)c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO4.C8H9NO2/c1-19(18(21-2)22-3)16-11-9-15(10-12-16)17(20)23-13-14-7-5-4-6-8-14;1-9-7-4-2-6(3-5-7)8(10)11/h4-12,18H,13H2,1-3H3;2-5,9H,1H3,(H,10,11) |
| InChIKey | HAFMXAXXBQKQTH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|