About cyclopenta-1,3-diene;tetrachlorotantalum
cyclopenta-1,3-diene;tetrachlorotantalum (PubChem CID 15842857) has the molecular formula C5H5Cl4Ta-
and a molecular weight of 387.86 g/mol. Its IUPAC name is cyclopenta-1,3-diene;tetrachlorotantalum.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;tetrachlorotantalum |
| PubChem CID | 15842857 |
| Molecular Formula | C5H5Cl4Ta- |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 385.86 |
| IUPAC Name | cyclopenta-1,3-diene;tetrachlorotantalum |
| SMILES | Cl[Ta](Cl)(Cl)Cl.c1cc[cH-]c1 |
| InChI | InChI=1S/C5H5.4ClH.Ta/c1-2-4-5-3-1;;;;;/h1-5H;4*1H;/q-1;;;;;+4/p-4 |
| InChIKey | LBHISSJHGOTZNQ-UHFFFAOYSA-J |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;tetrachlorotantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;tetrachlorotantalum?
The IUPAC name of cyclopenta-1,3-diene;tetrachlorotantalum (CID 15842857) is cyclopenta-1,3-diene;tetrachlorotantalum.
What is the SMILES notation for cyclopenta-1,3-diene;tetrachlorotantalum?
The canonical SMILES for cyclopenta-1,3-diene;tetrachlorotantalum is Cl[Ta](Cl)(Cl)Cl.c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;tetrachlorotantalum?
The InChIKey is LBHISSJHGOTZNQ-UHFFFAOYSA-J. The full InChI is InChI=1S/C5H5.4ClH.Ta/c1-2-4-5-3-1;;;;;/h1-5H;4*1H;/q-1;;;;;+4/p-4.
What are the key properties of cyclopenta-1,3-diene;tetrachlorotantalum?
cyclopenta-1,3-diene;tetrachlorotantalum has a molecular weight of 387.86 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;tetrachlorotantalum is sourced from PubChem (CID 15842857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).