About CID 158444799
CID 158444799 (PubChem CID 158444799) has the molecular formula C30H61N4O8P3W3
and a molecular weight of 1250.28 g/mol.
Molecular Properties
| Compound Name | CID 158444799 |
| PubChem CID | 158444799 |
| Molecular Formula | C30H61N4O8P3W3 |
| Molecular Weight | 1250.28 g/mol |
| Exact Mass | 1250.22 |
| IUPAC Name | — |
| SMILES | CCOCC1CN(P(C)(=[W])OCC2CN(P(C)(=[W])OCC3CN(P(C)(=[W])OCC4CN(C)CC(C)O4)CC(C)O3)CC(C)O2)CC(C)O1 |
| InChI | InChI=1S/C30H61N4O8P3.3W/c1-10-35-19-28-16-32(12-24(3)40-28)43(7)37-21-30-18-34(14-26(5)42-30)45(9)38-22-29-17-33(13-25(4)41-29)44(8)36-20-27-15-31(6)11-23(2)39-27;;;/h23-30H,10-22H2,1-9H3;;; |
| InChIKey | RHVSDVLEEFERQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1250.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 158444799 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158444799?
The IUPAC name of CID 158444799 (CID 158444799) is not available.
What is the SMILES notation for CID 158444799?
The canonical SMILES for CID 158444799 is CCOCC1CN(P(C)(=[W])OCC2CN(P(C)(=[W])OCC3CN(P(C)(=[W])OCC4CN(C)CC(C)O4)CC(C)O3)CC(C)O2)CC(C)O1.
What is the InChIKey of CID 158444799?
The InChIKey is RHVSDVLEEFERQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H61N4O8P3.3W/c1-10-35-19-28-16-32(12-24(3)40-28)43(7)37-21-30-18-34(14-26(5)42-30)45(9)38-22-29-17-33(13-25(4)41-29)44(8)36-20-27-15-31(6)11-23(2)39-27;;;/h23-30H,10-22H2,1-9H3;;;.
What are the key properties of CID 158444799?
CID 158444799 has a molecular weight of 1250.28 g/mol, XLogP of 3.88, 15 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158444799 is sourced from PubChem (CID 158444799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).