C30H61N4O8P3W3 — CID 158444799
CID 158444799 (PubChem CID 158444799) has the molecular formula C30H61N4O8P3W3 and a molecular weight of 1250.28 g/mol.
| Compound Name | CID 158444799 |
|---|---|
| PubChem CID | 158444799 |
| Molecular Formula | C30H61N4O8P3W3 |
| Molecular Weight | 1250.28 g/mol |
| Exact Mass | 1250.22 |
| IUPAC Name | — |
| SMILES | CCOCC1CN(P(C)(=[W])OCC2CN(P(C)(=[W])OCC3CN(P(C)(=[W])OCC4CN(C)CC(C)O4)CC(C)O3)CC(C)O2)CC(C)O1 |
| InChI | InChI=1S/C30H61N4O8P3.3W/c1-10-35-19-28-16-32(12-24(3)40-28)43(7)37-21-30-18-34(14-26(5)42-30)45(9)38-22-29-17-33(13-25(4)41-29)44(8)36-20-27-15-31(6)11-23(2)39-27;;;/h23-30H,10-22H2,1-9H3;;; |
| InChIKey | RHVSDVLEEFERQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1250.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|