C16H35N3O3P+ — CID 161302078
[1-[(4,6-dimethylmorpholin-2-yl)methoxy-methylphosphoryl]piperidin-4-yl]-trimethylazanium (PubChem CID 161302078) has the molecular formula C16H35N3O3P+ and a molecular weight of 348.45 g/mol. Its IUPAC name is [1-[(4,6-dimethylmorpholin-2-yl)methoxy-methylphosphoryl]piperidin-4-yl]-trimethylazanium.
| Compound Name | [1-[(4,6-dimethylmorpholin-2-yl)methoxy-methylphosphoryl]piperidin-4-yl]-trimethylazanium |
|---|---|
| PubChem CID | 161302078 |
| Molecular Formula | C16H35N3O3P+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [1-[(4,6-dimethylmorpholin-2-yl)methoxy-methylphosphoryl]piperidin-4-yl]-trimethylazanium |
| SMILES | CC1CN(C)CC(COP(C)(=O)N2CCC([N+](C)(C)C)CC2)O1 |
| InChI | InChI=1S/C16H35N3O3P/c1-14-11-17(2)12-16(22-14)13-21-23(6,20)18-9-7-15(8-10-18)19(3,4)5/h14-16H,7-13H2,1-6H3/q+1 |
| InChIKey | AKZPZYUUEOFDOB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|