C45H47BrN4O10 — CID 158448186
2-ethoxycarbonyl-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-5-carboxylic acid;ethyl 5-bromo-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-2-carboxylate (PubChem CID 158448186) has the molecular formula C45H47BrN4O10 and a molecular weight of 883.79 g/mol. Its IUPAC name is 2-ethoxycarbonyl-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-5-carboxylic acid;ethyl 5-bromo-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-2-carboxylate.
| Compound Name | 2-ethoxycarbonyl-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-5-carboxylic acid;ethyl 5-bromo-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 158448186 |
| Molecular Formula | C45H47BrN4O10 |
| Molecular Weight | 883.79 g/mol |
| Exact Mass | 882.25 |
| IUPAC Name | 2-ethoxycarbonyl-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-5-carboxylic acid;ethyl 5-bromo-3-[3-(phenylmethoxycarbonylamino)propyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Br)cc2c1CCCNC(=O)OCc1ccccc1.CCOC(=O)c1[nH]c2ccc(C(=O)O)cc2c1CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O6.C22H23BrN2O4/c1-2-30-22(28)20-17(18-13-16(21(26)27)10-11-19(18)25-20)9-6-12-24-23(29)31-14-15-7-4-3-5-8-15;1-2-28-21(26)20-17(18-13-16(23)10-11-19(18)25-20)9-6-12-24-22(27)29-14-15-7-4-3-5-8-15/h3-5,7-8,10-11,13,25H,2,6,9,12,14H2,1H3,(H,24,29)(H,26,27);3-5,7-8,10-11,13,25H,2,6,9,12,14H2,1H3,(H,24,27) |
| InChIKey | HDQLNOVEBFWSTC-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 198.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.79 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|