C23H48 — CID 158451501
2,14-dimethyl-7,9-di(propan-2-yl)pentadecane (PubChem CID 158451501) has the molecular formula C23H48 and a molecular weight of 324.64 g/mol. Its IUPAC name is 2,14-dimethyl-7,9-di(propan-2-yl)pentadecane.
| Compound Name | 2,14-dimethyl-7,9-di(propan-2-yl)pentadecane |
|---|---|
| PubChem CID | 158451501 |
| Molecular Formula | C23H48 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.38 |
| IUPAC Name | 2,14-dimethyl-7,9-di(propan-2-yl)pentadecane |
| SMILES | CC(C)CCCCC(CC(CCCCC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C23H48/c1-18(2)13-9-11-15-22(20(5)6)17-23(21(7)8)16-12-10-14-19(3)4/h18-23H,9-17H2,1-8H3 |
| InChIKey | XUNHCYZHRUHGQK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|