C28H29N3O4 — CID 158460804
ethyl 3-(aminomethylamino)-3-[4-[[(1R)-4-(4-cyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]propanoate (PubChem CID 158460804) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is ethyl 3-(aminomethylamino)-3-[4-[[(1R)-4-(4-cyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]propanoate.
| Compound Name | ethyl 3-(aminomethylamino)-3-[4-[[(1R)-4-(4-cyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 158460804 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | ethyl 3-(aminomethylamino)-3-[4-[[(1R)-4-(4-cyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]propanoate |
| SMILES | CCOC(=O)CC(NCN)c1ccc(O[C@@H]2CCc3c(Oc4ccc(C#N)cc4)cccc32)cc1 |
| InChI | InChI=1S/C28H29N3O4/c1-2-33-28(32)16-25(31-18-30)20-8-12-22(13-9-20)35-27-15-14-24-23(27)4-3-5-26(24)34-21-10-6-19(17-29)7-11-21/h3-13,25,27,31H,2,14-16,18,30H2,1H3/t25?,27-/m1/s1 |
| InChIKey | LTLDYKFZPWWNHL-ZCJYOONXSA-N |
| XLogP | 4.92 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|