C36H24N2Pd — CID 158462069
3-(1,2-diphenyl-4-pyridin-2-ylbuta-1,3-dienyl)-1-phenylisoquinoline;palladium(2+) (PubChem CID 158462069) has the molecular formula C36H24N2Pd and a molecular weight of 591.02 g/mol. Its IUPAC name is 3-(1,2-diphenyl-4-pyridin-2-ylbuta-1,3-dienyl)-1-phenylisoquinoline;palladium(2+).
| Compound Name | 3-(1,2-diphenyl-4-pyridin-2-ylbuta-1,3-dienyl)-1-phenylisoquinoline;palladium(2+) |
|---|---|
| PubChem CID | 158462069 |
| Molecular Formula | C36H24N2Pd |
| Molecular Weight | 591.02 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 3-(1,2-diphenyl-4-pyridin-2-ylbuta-1,3-dienyl)-1-phenylisoquinoline;palladium(2+) |
| SMILES | [C-](=C/c1ccccn1)\C(=C(c1ccccc1)c1cc2ccccc2c(-c2[c-]cccc2)n1)c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C36H24N2.Pd/c1-4-14-27(15-5-1)32(24-23-31-21-12-13-25-37-31)35(28-16-6-2-7-17-28)34-26-30-20-10-11-22-33(30)36(38-34)29-18-8-3-9-19-29;/h1-18,20-23,25-26H;/q-2;+2 |
| InChIKey | YEKZFEGMETVFLY-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.02 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|