About palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline
palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline (PubChem CID 58251438) has the molecular formula C28H18N2Pd
and a molecular weight of 488.89 g/mol. Its IUPAC name is palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline.
Molecular Properties
| Compound Name | palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline |
| PubChem CID | 58251438 |
| Molecular Formula | C28H18N2Pd |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline |
| SMILES | [C-](=C/c1ccccn1)\c1ccccc1-c1cc2ccccc2c(-c2[c-]cccc2)n1.[Pd+2] |
| InChI | InChI=1S/C28H18N2.Pd/c1-2-11-22(12-3-1)28-26-16-7-5-13-23(26)20-27(30-28)25-15-6-4-10-21(25)17-18-24-14-8-9-19-29-24;/h1-11,13-16,18-20H;/q-2;+2 |
| InChIKey | HSNHZLQGFRJSPJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline?
The IUPAC name of palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline (CID 58251438) is palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline.
What is the SMILES notation for palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline?
The canonical SMILES for palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline is [C-](=C/c1ccccn1)\c1ccccc1-c1cc2ccccc2c(-c2[c-]cccc2)n1.[Pd+2].
What is the InChIKey of palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline?
The InChIKey is HSNHZLQGFRJSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18N2.Pd/c1-2-11-22(12-3-1)28-26-16-7-5-13-23(26)20-27(30-28)25-15-6-4-10-21(25)17-18-24-14-8-9-19-29-24;/h1-11,13-16,18-20H;/q-2;+2.
What are the key properties of palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline?
palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline has a molecular weight of 488.89 g/mol, XLogP of 6.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);1-phenyl-3-[2-(2-pyridin-2-ylethenyl)phenyl]isoquinoline is sourced from PubChem (CID 58251438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).