C18H31NO7 — CID 158465886
[(4S,5S)-6-[(2R)-1-(2-acetamidoethoxy)propan-2-yl]-2-acetyloxy-4,5-dimethyloxan-3-yl] acetate (PubChem CID 158465886) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is [(4S,5S)-6-[(2R)-1-(2-acetamidoethoxy)propan-2-yl]-2-acetyloxy-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(4S,5S)-6-[(2R)-1-(2-acetamidoethoxy)propan-2-yl]-2-acetyloxy-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 158465886 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | [(4S,5S)-6-[(2R)-1-(2-acetamidoethoxy)propan-2-yl]-2-acetyloxy-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)NCCOC[C@@H](C)C1OC(OC(C)=O)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H31NO7/c1-10(9-23-8-7-19-13(4)20)16-11(2)12(3)17(24-14(5)21)18(26-16)25-15(6)22/h10-12,16-18H,7-9H2,1-6H3,(H,19,20)/t10-,11+,12+,16?,17?,18?/m1/s1 |
| InChIKey | LNVKWADFGHAYPG-ISEIFREHSA-N |
| XLogP | 1.27 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|