C47H64F7OS3+3 — CID 158469014
dimethyl(phenyl)sulfanium;[4-(4,4,6,6,7,7,7-heptafluoroheptoxy)-3,5-dimethylphenyl]-diphenylsulfanium;tributylsulfanium (PubChem CID 158469014) has the molecular formula C47H64F7OS3+3 and a molecular weight of 874.22 g/mol. Its IUPAC name is dimethyl(phenyl)sulfanium;[4-(4,4,6,6,7,7,7-heptafluoroheptoxy)-3,5-dimethylphenyl]-diphenylsulfanium;tributylsulfanium.
| Compound Name | dimethyl(phenyl)sulfanium;[4-(4,4,6,6,7,7,7-heptafluoroheptoxy)-3,5-dimethylphenyl]-diphenylsulfanium;tributylsulfanium |
|---|---|
| PubChem CID | 158469014 |
| Molecular Formula | C47H64F7OS3+3 |
| Molecular Weight | 874.22 g/mol |
| Exact Mass | 873.40 |
| IUPAC Name | dimethyl(phenyl)sulfanium;[4-(4,4,6,6,7,7,7-heptafluoroheptoxy)-3,5-dimethylphenyl]-diphenylsulfanium;tributylsulfanium |
| SMILES | CCCC[S+](CCCC)CCCC.C[S+](C)c1ccccc1.Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCCCC(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H26F7OS.C12H27S.C8H11S/c1-19-16-23(36(21-10-5-3-6-11-21)22-12-7-4-8-13-22)17-20(2)24(19)35-15-9-14-25(28,29)18-26(30,31)27(32,33)34;1-4-7-10-13(11-8-5-2)12-9-6-3;1-9(2)8-6-4-3-5-7-8/h3-8,10-13,16-17H,9,14-15,18H2,1-2H3;4-12H2,1-3H3;3-7H,1-2H3/q3*+1 |
| InChIKey | HGCQCGNDZQXOPK-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.22 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|