C51H42O13 — CID 158470940
2-(3,4-dimethoxybenzoyl)indene-1,3-dione;1-[2-hydroxy-4-(methoxymethoxy)phenyl]-3-phenylpropane-1,3-dione;(6-methoxy-1-benzofuran-5-yl)-phenylmethanone (PubChem CID 158470940) has the molecular formula C51H42O13 and a molecular weight of 862.88 g/mol. Its IUPAC name is 2-(3,4-dimethoxybenzoyl)indene-1,3-dione;1-[2-hydroxy-4-(methoxymethoxy)phenyl]-3-phenylpropane-1,3-dione;(6-methoxy-1-benzofuran-5-yl)-phenylmethanone.
| Compound Name | 2-(3,4-dimethoxybenzoyl)indene-1,3-dione;1-[2-hydroxy-4-(methoxymethoxy)phenyl]-3-phenylpropane-1,3-dione;(6-methoxy-1-benzofuran-5-yl)-phenylmethanone |
|---|---|
| PubChem CID | 158470940 |
| Molecular Formula | C51H42O13 |
| Molecular Weight | 862.88 g/mol |
| Exact Mass | 862.26 |
| IUPAC Name | 2-(3,4-dimethoxybenzoyl)indene-1,3-dione;1-[2-hydroxy-4-(methoxymethoxy)phenyl]-3-phenylpropane-1,3-dione;(6-methoxy-1-benzofuran-5-yl)-phenylmethanone |
| SMILES | COCOc1ccc(C(=O)CC(=O)c2ccccc2)c(O)c1.COc1cc2occc2cc1C(=O)c1ccccc1.COc1ccc(C(=O)C2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H14O5.C17H16O5.C16H12O3/c1-22-13-8-7-10(9-14(13)23-2)16(19)15-17(20)11-5-3-4-6-12(11)18(15)21;1-21-11-22-13-7-8-14(16(19)9-13)17(20)10-15(18)12-5-3-2-4-6-12;1-18-15-10-14-12(7-8-19-14)9-13(15)16(17)11-5-3-2-4-6-11/h3-9,15H,1-2H3;2-9,19H,10-11H2,1H3;2-10H,1H3 |
| InChIKey | HGILZYBNPXNFOU-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 181.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.88 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|