C51H62N2O4Si — CID 158476291
3-(4-hydroxyphenyl)-1-isoquinolin-6-ylhexan-2-one;1-isoquinolin-6-yl-3-[4-tri(propan-2-yl)silyloxyphenyl]hexan-2-one (PubChem CID 158476291) has the molecular formula C51H62N2O4Si and a molecular weight of 795.15 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1-isoquinolin-6-ylhexan-2-one;1-isoquinolin-6-yl-3-[4-tri(propan-2-yl)silyloxyphenyl]hexan-2-one.
| Compound Name | 3-(4-hydroxyphenyl)-1-isoquinolin-6-ylhexan-2-one;1-isoquinolin-6-yl-3-[4-tri(propan-2-yl)silyloxyphenyl]hexan-2-one |
|---|---|
| PubChem CID | 158476291 |
| Molecular Formula | C51H62N2O4Si |
| Molecular Weight | 795.15 g/mol |
| Exact Mass | 794.45 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1-isoquinolin-6-ylhexan-2-one;1-isoquinolin-6-yl-3-[4-tri(propan-2-yl)silyloxyphenyl]hexan-2-one |
| SMILES | CCCC(C(=O)Cc1ccc2cnccc2c1)c1ccc(O)cc1.CCCC(C(=O)Cc1ccc2cnccc2c1)c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C30H41NO2Si.C21H21NO2/c1-8-9-29(30(32)19-24-10-11-27-20-31-17-16-26(27)18-24)25-12-14-28(15-13-25)33-34(21(2)3,22(4)5)23(6)7;1-2-3-20(16-6-8-19(23)9-7-16)21(24)13-15-4-5-18-14-22-11-10-17(18)12-15/h10-18,20-23,29H,8-9,19H2,1-7H3;4-12,14,20,23H,2-3,13H2,1H3 |
| InChIKey | HGZBVDAPVVYENA-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.15 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|