C25H20N3+ — CID 158478380
9-(2,4-dimethylphthalazin-2-ium-1-yl)-10-methyl-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,9,11(15),12-heptaene (PubChem CID 158478380) has the molecular formula C25H20N3+ and a molecular weight of 362.46 g/mol. Its IUPAC name is 9-(2,4-dimethylphthalazin-2-ium-1-yl)-10-methyl-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,9,11(15),12-heptaene.
| Compound Name | 9-(2,4-dimethylphthalazin-2-ium-1-yl)-10-methyl-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,9,11(15),12-heptaene |
|---|---|
| PubChem CID | 158478380 |
| Molecular Formula | C25H20N3+ |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 9-(2,4-dimethylphthalazin-2-ium-1-yl)-10-methyl-8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,9,11(15),12-heptaene |
| SMILES | Cc1n[n+](C)c(-c2c(C)c3cccc4c5ccccc5n2c34)c2ccccc12 |
| InChI | InChI=1S/C25H20N3/c1-15-17-12-8-13-21-19-10-6-7-14-22(19)28(24(17)21)23(15)25-20-11-5-4-9-18(20)16(2)26-27(25)3/h4-14H,1-3H3/q+1 |
| InChIKey | PHDDAWDWEDPAMW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|