C32H46N6O6 — CID 158481841
(2R,5S)-5-[[(2R,5S)-2-(4-azidobutyl)-6-(3H-inden-1-yl)-5-methyl-4-oxohexanoyl]amino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoic acid (PubChem CID 158481841) has the molecular formula C32H46N6O6 and a molecular weight of 610.76 g/mol. Its IUPAC name is (2R,5S)-5-[[(2R,5S)-2-(4-azidobutyl)-6-(3H-inden-1-yl)-5-methyl-4-oxohexanoyl]amino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoic acid.
| Compound Name | (2R,5S)-5-[[(2R,5S)-2-(4-azidobutyl)-6-(3H-inden-1-yl)-5-methyl-4-oxohexanoyl]amino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 158481841 |
| Molecular Formula | C32H46N6O6 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | (2R,5S)-5-[[(2R,5S)-2-(4-azidobutyl)-6-(3H-inden-1-yl)-5-methyl-4-oxohexanoyl]amino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CCCCN=[N+]=[N-])CC(=O)[C@@H](C)CC1=CCc2ccccc21)C(=O)C[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C32H46N6O6/c1-20(2)29(28(40)19-25(31(42)43)11-8-15-35-32(33)44)37-30(41)24(10-6-7-16-36-38-34)18-27(39)21(3)17-23-14-13-22-9-4-5-12-26(22)23/h4-5,9,12,14,20-21,24-25,29H,6-8,10-11,13,15-19H2,1-3H3,(H,37,41)(H,42,43)(H3,33,35,44)/t21-,24+,25+,29-/m0/s1 |
| InChIKey | NBGYNDYPXLSGMN-LGZHOBANSA-N |
| XLogP | 4.96 |
| TPSA | 204.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|