C24H36N4O3 — CID 165015963
(2S)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-(3H-inden-1-yl)-2-(propan-2-ylamino)propanamide (PubChem CID 165015963) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is (2S)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-(3H-inden-1-yl)-2-(propan-2-ylamino)propanamide.
| Compound Name | (2S)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-(3H-inden-1-yl)-2-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 165015963 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (2S)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-(3H-inden-1-yl)-2-(propan-2-ylamino)propanamide |
| SMILES | CC(C)N[C@@H](CC1=CCc2ccccc21)C(=O)N[C@@H](CCCNC(N)=O)C(=O)C(C)C |
| InChI | InChI=1S/C24H36N4O3/c1-15(2)22(29)20(10-7-13-26-24(25)31)28-23(30)21(27-16(3)4)14-18-12-11-17-8-5-6-9-19(17)18/h5-6,8-9,12,15-16,20-21,27H,7,10-11,13-14H2,1-4H3,(H,28,30)(H3,25,26,31)/t20-,21-/m0/s1 |
| InChIKey | KKPLBMCIYDVNCX-SFTDATJTSA-N |
| XLogP | 2.54 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|