C24H40O12S4 — CID 158482853
[(3R,4S)-5-acetyloxy-4-methyl-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate;[(3R,4S)-5,6-diacetyloxy-4-methyloxan-3-yl] acetate;methanedithiol (PubChem CID 158482853) has the molecular formula C24H40O12S4 and a molecular weight of 648.84 g/mol. Its IUPAC name is [(3R,4S)-5-acetyloxy-4-methyl-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate;[(3R,4S)-5,6-diacetyloxy-4-methyloxan-3-yl] acetate;methanedithiol.
| Compound Name | [(3R,4S)-5-acetyloxy-4-methyl-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate;[(3R,4S)-5,6-diacetyloxy-4-methyloxan-3-yl] acetate;methanedithiol |
|---|---|
| PubChem CID | 158482853 |
| Molecular Formula | C24H40O12S4 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | [(3R,4S)-5-acetyloxy-4-methyl-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate;[(3R,4S)-5,6-diacetyloxy-4-methyloxan-3-yl] acetate;methanedithiol |
| SMILES | CC(=O)OC1C(SCS)OC[C@H](OC(C)=O)[C@@H]1C.CC(=O)OC1OC[C@H](OC(C)=O)[C@H](C)C1OC(C)=O.SCS |
| InChI | InChI=1S/C12H18O7.C11H18O5S2.CH4S2/c1-6-10(17-7(2)13)5-16-12(19-9(4)15)11(6)18-8(3)14;1-6-9(15-7(2)12)4-14-11(18-5-17)10(6)16-8(3)13;2-1-3/h6,10-12H,5H2,1-4H3;6,9-11,17H,4-5H2,1-3H3;2-3H,1H2/t6-,10-,11?,12?;6-,9-,10?,11?;/m00./s1 |
| InChIKey | HHSSGTMNEMAJFP-FKKJIFPNSA-N |
| XLogP | 2.67 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|