About 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one
1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one (PubChem CID 158487928) has the molecular formula C22H44N2O2
and a molecular weight of 368.61 g/mol. Its IUPAC name is 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one.
Molecular Properties
| Compound Name | 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one |
| PubChem CID | 158487928 |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one |
| SMILES | CC(C)(C)N1CCCCC1.CCC(O)C(=O)C1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25NO2.C9H19N/c1-5-11(15)12(16)10-6-8-14(9-7-10)13(2,3)4;1-9(2,3)10-7-5-4-6-8-10/h10-11,15H,5-9H2,1-4H3;4-8H2,1-3H3 |
| InChIKey | HIIHMIDYPYANBM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one?
The IUPAC name of 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one (CID 158487928) is 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one.
What is the SMILES notation for 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one?
The canonical SMILES for 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one is CC(C)(C)N1CCCCC1.CCC(O)C(=O)C1CCN(C(C)(C)C)CC1.
What is the InChIKey of 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one?
The InChIKey is HIIHMIDYPYANBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2.C9H19N/c1-5-11(15)12(16)10-6-8-14(9-7-10)13(2,3)4;1-9(2,3)10-7-5-4-6-8-10/h10-11,15H,5-9H2,1-4H3;4-8H2,1-3H3.
What are the key properties of 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one?
1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one has a molecular weight of 368.61 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpiperidine;1-(1-tert-butylpiperidin-4-yl)-2-hydroxybutan-1-one is sourced from PubChem (CID 158487928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).