C21H44N2O — CID 160970317
1-tert-butylpiperidine;1-(4-tert-butylpiperidin-1-yl)ethanone;methane (PubChem CID 160970317) has the molecular formula C21H44N2O and a molecular weight of 340.60 g/mol. Its IUPAC name is 1-tert-butylpiperidine;1-(4-tert-butylpiperidin-1-yl)ethanone;methane.
| Compound Name | 1-tert-butylpiperidine;1-(4-tert-butylpiperidin-1-yl)ethanone;methane |
|---|---|
| PubChem CID | 160970317 |
| Molecular Formula | C21H44N2O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.35 |
| IUPAC Name | 1-tert-butylpiperidine;1-(4-tert-butylpiperidin-1-yl)ethanone;methane |
| SMILES | C.CC(=O)N1CCC(C(C)(C)C)CC1.CC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C11H21NO.C9H19N.CH4/c1-9(13)12-7-5-10(6-8-12)11(2,3)4;1-9(2,3)10-7-5-4-6-8-10;/h10H,5-8H2,1-4H3;4-8H2,1-3H3;1H4 |
| InChIKey | SYDXZPSTHCQJHJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |