C28H52P2 — CID 15849451
ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-ethyl-4,6-dimethylphenyl]methyl]phosphane (PubChem CID 15849451) has the molecular formula C28H52P2 and a molecular weight of 450.67 g/mol. Its IUPAC name is ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-ethyl-4,6-dimethylphenyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-ethyl-4,6-dimethylphenyl]methyl]phosphane |
|---|---|
| PubChem CID | 15849451 |
| Molecular Formula | C28H52P2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-ethyl-4,6-dimethylphenyl]methyl]phosphane |
| SMILES | CCc1c(CP(C(C)(C)C)C(C)(C)C)c(C)cc(C)c1CP(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H52P2/c1-16-22-23(18-29(25(4,5)6)26(7,8)9)20(2)17-21(3)24(22)19-30(27(10,11)12)28(13,14)15/h17H,16,18-19H2,1-15H3 |
| InChIKey | QDBJPEGFBLITCV-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|