C18H30 — CID 167475137
acetylene;butane;3-ethyl-1,2,4,5-tetramethylbenzene (PubChem CID 167475137) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is acetylene;butane;3-ethyl-1,2,4,5-tetramethylbenzene.
| Compound Name | acetylene;butane;3-ethyl-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 167475137 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | acetylene;butane;3-ethyl-1,2,4,5-tetramethylbenzene |
| SMILES | C#C.CCCC.CCc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C12H18.C4H10.C2H2/c1-6-12-10(4)8(2)7-9(3)11(12)5;1-3-4-2;1-2/h7H,6H2,1-5H3;3-4H2,1-2H3;1-2H |
| InChIKey | SQYVHYKREITBBM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|