About 5-ethyl-4,6-dimethylpyridin-2-amine
5-ethyl-4,6-dimethylpyridin-2-amine (PubChem CID 45079042) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-ethyl-4,6-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-ethyl-4,6-dimethylpyridin-2-amine |
| PubChem CID | 45079042 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-ethyl-4,6-dimethylpyridin-2-amine |
| SMILES | CCc1c(C)cc(N)nc1C |
| InChI | InChI=1S/C9H14N2/c1-4-8-6(2)5-9(10)11-7(8)3/h5H,4H2,1-3H3,(H2,10,11) |
| InChIKey | HLXHZLJUDVPVFR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-4,6-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,6-dimethylpyridin-2-amine?
The IUPAC name of 5-ethyl-4,6-dimethylpyridin-2-amine (CID 45079042) is 5-ethyl-4,6-dimethylpyridin-2-amine.
What is the SMILES notation for 5-ethyl-4,6-dimethylpyridin-2-amine?
The canonical SMILES for 5-ethyl-4,6-dimethylpyridin-2-amine is CCc1c(C)cc(N)nc1C.
What is the InChIKey of 5-ethyl-4,6-dimethylpyridin-2-amine?
The InChIKey is HLXHZLJUDVPVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-4-8-6(2)5-9(10)11-7(8)3/h5H,4H2,1-3H3,(H2,10,11).
What are the key properties of 5-ethyl-4,6-dimethylpyridin-2-amine?
5-ethyl-4,6-dimethylpyridin-2-amine has a molecular weight of 150.22 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,6-dimethylpyridin-2-amine is sourced from PubChem (CID 45079042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).