C8H11ClN2 — CID 145002193
5-(chloromethyl)-4,6-dimethylpyridin-2-amine (PubChem CID 145002193) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 5-(chloromethyl)-4,6-dimethylpyridin-2-amine.
| Compound Name | 5-(chloromethyl)-4,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 145002193 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-(chloromethyl)-4,6-dimethylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C)c1CCl |
| InChI | InChI=1S/C8H11ClN2/c1-5-3-8(10)11-6(2)7(5)4-9/h3H,4H2,1-2H3,(H2,10,11) |
| InChIKey | DPOOOIUIZKHURZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|