C7H10ClN3 — CID 118668730
5-N-chloro-4,6-dimethylpyridine-2,5-diamine (PubChem CID 118668730) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 5-N-chloro-4,6-dimethylpyridine-2,5-diamine.
| Compound Name | 5-N-chloro-4,6-dimethylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 118668730 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 5-N-chloro-4,6-dimethylpyridine-2,5-diamine |
| SMILES | Cc1cc(N)nc(C)c1NCl |
| InChI | InChI=1S/C7H10ClN3/c1-4-3-6(9)10-5(2)7(4)11-8/h3,11H,1-2H3,(H2,9,10) |
| InChIKey | HBZOACIQURFPNG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|