C33H36BBr2Cl3N6O4 — CID 158495250
5-bromo-4-chloro-1H-indazole;5-bromo-4-chloro-2-(2-methoxyethyl)indazole;4-chloro-2-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 158495250) has the molecular formula C33H36BBr2Cl3N6O4 and a molecular weight of 857.67 g/mol. Its IUPAC name is 5-bromo-4-chloro-1H-indazole;5-bromo-4-chloro-2-(2-methoxyethyl)indazole;4-chloro-2-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-4-chloro-1H-indazole;5-bromo-4-chloro-2-(2-methoxyethyl)indazole;4-chloro-2-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 158495250 |
| Molecular Formula | C33H36BBr2Cl3N6O4 |
| Molecular Weight | 857.67 g/mol |
| Exact Mass | 854.03 |
| IUPAC Name | 5-bromo-4-chloro-1H-indazole;5-bromo-4-chloro-2-(2-methoxyethyl)indazole;4-chloro-2-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | COCCn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1.COCCn1cc2c(Cl)c(Br)ccc2n1.Clc1c(Br)ccc2[nH]ncc12 |
| InChI | InChI=1S/C16H22BClN2O3.C10H10BrClN2O.C7H4BrClN2/c1-15(2)16(3,4)23-17(22-15)12-6-7-13-11(14(12)18)10-20(19-13)8-9-21-5;1-15-5-4-14-6-7-9(13-14)3-2-8(11)10(7)12;8-5-1-2-6-4(7(5)9)3-10-11-6/h6-7,10H,8-9H2,1-5H3;2-3,6H,4-5H2,1H3;1-3H,(H,10,11) |
| InChIKey | HJEXARAYKSRBGL-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.67 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|