C22H24BBrCl2N4O2 — CID 159882701
5-bromo-4-chloro-2-methylindazole;4-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 159882701) has the molecular formula C22H24BBrCl2N4O2 and a molecular weight of 538.08 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-methylindazole;4-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-4-chloro-2-methylindazole;4-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 159882701 |
| Molecular Formula | C22H24BBrCl2N4O2 |
| Molecular Weight | 538.08 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 5-bromo-4-chloro-2-methylindazole;4-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1.Cn1cc2c(Cl)c(Br)ccc2n1 |
| InChI | InChI=1S/C14H18BClN2O2.C8H6BrClN2/c1-13(2)14(3,4)20-15(19-13)10-6-7-11-9(12(10)16)8-18(5)17-11;1-12-4-5-7(11-12)3-2-6(9)8(5)10/h6-8H,1-5H3;2-4H,1H3 |
| InChIKey | NTSNRZUBSUHOLC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.08 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|