C20H44OSi3 — CID 15850216
2,6-dimethyl-2,6-bis(trimethylsilyl)-4-(2-trimethylsilylethynyl)heptan-4-ol (PubChem CID 15850216) has the molecular formula C20H44OSi3 and a molecular weight of 384.83 g/mol. Its IUPAC name is 2,6-dimethyl-2,6-bis(trimethylsilyl)-4-(2-trimethylsilylethynyl)heptan-4-ol.
| Compound Name | 2,6-dimethyl-2,6-bis(trimethylsilyl)-4-(2-trimethylsilylethynyl)heptan-4-ol |
|---|---|
| PubChem CID | 15850216 |
| Molecular Formula | C20H44OSi3 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2,6-dimethyl-2,6-bis(trimethylsilyl)-4-(2-trimethylsilylethynyl)heptan-4-ol |
| SMILES | CC(C)(CC(O)(C#C[Si](C)(C)C)CC(C)(C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H44OSi3/c1-18(2,23(8,9)10)16-20(21,14-15-22(5,6)7)17-19(3,4)24(11,12)13/h21H,16-17H2,1-13H3 |
| InChIKey | VGOUJLZFSKFTBM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|