C28H30F5N3O4S — CID 158506056
4-[9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2-tetrafluoropropan-2-yl)-6,6a,8,9-tetrahydro-5H-pyrrolo[2,3-h]quinoline-7-carbonyl]cyclohexane-1-carboxamide (PubChem CID 158506056) has the molecular formula C28H30F5N3O4S and a molecular weight of 599.62 g/mol. Its IUPAC name is 4-[9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2-tetrafluoropropan-2-yl)-6,6a,8,9-tetrahydro-5H-pyrrolo[2,3-h]quinoline-7-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2-tetrafluoropropan-2-yl)-6,6a,8,9-tetrahydro-5H-pyrrolo[2,3-h]quinoline-7-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 158506056 |
| Molecular Formula | C28H30F5N3O4S |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | 4-[9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2-tetrafluoropropan-2-yl)-6,6a,8,9-tetrahydro-5H-pyrrolo[2,3-h]quinoline-7-carbonyl]cyclohexane-1-carboxamide |
| SMILES | CC(F)(c1cnc2c(c1)CCC1N(C(=O)C3CCC(C(N)=O)CC3)CCC21S(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C28H30F5N3O4S/c1-26(30,28(31,32)33)19-14-18-6-11-22-27(23(18)35-15-19,41(39,40)21-9-7-20(29)8-10-21)12-13-36(22)25(38)17-4-2-16(3-5-17)24(34)37/h7-10,14-17,22H,2-6,11-13H2,1H3,(H2,34,37) |
| InChIKey | HKMBJETZDSMFAJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |