C19H32B3FO11 — CID 158506441
CID 158506441 (PubChem CID 158506441) has the molecular formula C19H32B3FO11 and a molecular weight of 487.89 g/mol.
| Compound Name | CID 158506441 |
|---|---|
| PubChem CID | 158506441 |
| Molecular Formula | C19H32B3FO11 |
| Molecular Weight | 487.89 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1C(=C)[C@H](CO)[C@@H](O)[C@@]1(C)O.[B][C@@H]1O[C@H](CO)[C@](C)(O)[C@H]1O.[B][C@@H]1O[C@](F)(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13BO3.C6H11BO4.C5H8BFO4/c1-4-5(3-10)7(11)8(2,12)6(4)9;1-6(10)3(2-8)11-5(7)4(6)9;6-4-2(9)3(10)5(7,1-8)11-4/h5-7,10-12H,1,3H2,2H3;3-5,8-10H,2H2,1H3;2-4,8-10H,1H2/t5-,6+,7+,8-;3-,4+,5-,6+;2-,3+,4-,5-/m011/s1 |
| InChIKey | PQFCIMBMZHNMDD-LLZCMDNNSA-N |
| XLogP | -4.89 |
| TPSA | 200.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.89 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|