C5H8BFO4 — CID 58682564
CID 58682564 (PubChem CID 58682564) has the molecular formula C5H8BFO4 and a molecular weight of 161.92 g/mol.
| Compound Name | CID 58682564 |
|---|---|
| PubChem CID | 58682564 |
| Molecular Formula | C5H8BFO4 |
| Molecular Weight | 161.92 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@](F)(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H8BFO4/c6-4-2(9)3(10)5(7,1-8)11-4/h2-4,8-10H,1H2/t2-,3+,4-,5-/m1/s1 |
| InChIKey | BLJMNXMEBVMJDB-KKQCNMDGSA-N |
| XLogP | -2.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.92 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|