C13H17FN2O8 — CID 177261225
[3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl propanoate (PubChem CID 177261225) has the molecular formula C13H17FN2O8 and a molecular weight of 348.28 g/mol. Its IUPAC name is [3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl propanoate.
| Compound Name | [3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl propanoate |
|---|---|
| PubChem CID | 177261225 |
| Molecular Formula | C13H17FN2O8 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl propanoate |
| SMILES | CCC(=O)OCn1c(=O)ccn([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C13H17FN2O8/c1-2-8(19)23-6-16-7(18)3-4-15(12(16)22)11-9(20)10(21)13(14,5-17)24-11/h3-4,9-11,17,20-21H,2,5-6H2,1H3/t9-,10+,11-,13-/m1/s1 |
| InChIKey | OGFJFAQNCMQAJD-LSCVPOLPSA-N |
| XLogP | -2.17 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |